EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H62N6O11 |
| Net Charge | 0 |
| Average Mass | 839.000 |
| Monoisotopic Mass | 838.44766 |
| SMILES | CCC(C)CCCCCCCCC(=O)N(C)[C@H](CO)C(=O)N[C@H](C)C(=O)NCC(=O)N(C)C1C(=O)N[C@@H](C)C(=O)NC(C(=O)O)Cc2ccc(O)c(c2)-c2cc1ccc2O |
| InChI | InChI=1S/C43H62N6O11/c1-7-25(2)14-12-10-8-9-11-13-15-36(53)48(5)33(24-50)41(57)45-26(3)39(55)44-23-37(54)49(6)38-29-17-19-35(52)31(22-29)30-20-28(16-18-34(30)51)21-32(43(59)60)47-40(56)27(4)46-42(38)58/h16-20,22,25-27,32-33,38,50-52H,7-15,21,23-24H2,1-6H3,(H,44,55)(H,45,57)(H,46,58)(H,47,56)(H,59,60)/t25?,26-,27+,32?,33-,38?/m1/s1 |
| InChIKey | YGPDJLNYORNORK-QAZUVEQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies Tue 6075 (ncbitaxon:1661694) | - | PubMed (12195962) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arylomycin A4 (CHEBI:210325) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (11S)-3,18-dihydroxy-14-[[2-[[(2R)-2-[[(2R)-3-hydroxy-2-[methyl(10-methyldodecanoyl)amino]propanoyl]amino]propanoyl]amino]acetyl]-methylamino]-11-methyl-10,13-dioxo-9,12-diazatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 9160903 | ChemSpider |