EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48N2O7 |
| Net Charge | 0 |
| Average Mass | 596.765 |
| Monoisotopic Mass | 596.34615 |
| SMILES | CO[C@H]1C=CC=CC=CC[C@H](O)[C@H](C)[C@@H](OC(=O)[C@@H](C)NC(=O)CC(C)C)C(C)=CCCc2cc(O)cc(c2)NC(=O)C1 |
| InChI | InChI=1S/C34H48N2O7/c1-22(2)17-31(39)35-25(5)34(41)43-33-23(3)13-12-14-26-18-27(20-28(37)19-26)36-32(40)21-29(42-6)15-10-8-7-9-11-16-30(38)24(33)4/h7-11,13,15,18-20,22,24-25,29-30,33,37-38H,12,14,16-17,21H2,1-6H3,(H,35,39)(H,36,40)/t24-,25+,29-,30-,33-/m0/s1 |
| InChIKey | AOIICUUMXAPJHS-RPQORNJFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30132670) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trienomycin L (CHEBI:210302) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(5R,13S,14S,15R)-13,22-dihydroxy-5-methoxy-14,16-dimethyl-3-oxo-2-azabicyclo[18.3.1]tetracosa-1(23),6,8,10,16,20(24),21-heptaen-15-yl] (2R)-2-(3-methylbutanoylamino)propanoate |