EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H46N2O7 |
| Net Charge | 0 |
| Average Mass | 582.738 |
| Monoisotopic Mass | 582.33050 |
| SMILES | CCCC(=O)N[C@H](C)C(=O)O[C@H]1CC=CC=CC=C[C@H](OC)CC(=O)Nc2cc(O)cc(c2)CCC=C(C)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C33H46N2O7/c1-6-13-30(37)34-24(4)33(40)42-29-17-11-9-7-8-10-16-28(41-5)21-31(38)35-26-18-25(19-27(36)20-26)15-12-14-22(2)32(39)23(29)3/h7-11,14,16,18-20,23-24,28-29,32,36,39H,6,12-13,15,17,21H2,1-5H3,(H,34,37)(H,35,38)/t23-,24+,28-,29-,32-/m0/s1 |
| InChIKey | QQOGUOJNGXXPQE-HAZHQEIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30132670) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trienomycin K (CHEBI:210296) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(5R,13S,14R,15R)-15,22-dihydroxy-5-methoxy-14,16-dimethyl-3-oxo-2-azabicyclo[18.3.1]tetracosa-1(23),6,8,10,16,20(24),21-heptaen-13-yl] (2R)-2-(butanoylamino)propanoate |