EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H52N2O7 |
| Net Charge | 0 |
| Average Mass | 624.819 |
| Monoisotopic Mass | 624.37745 |
| SMILES | CO[C@H]1C=CC=CC=CC[C@H](OC(=O)[C@@H](C)NC(=O)CCCC(C)C)[C@H](C)[C@@H](O)C(C)=CCCc2cc(O)cc(c2)NC(=O)C1 |
| InChI | InChI=1S/C36H52N2O7/c1-24(2)14-12-19-33(40)37-27(5)36(43)45-32-18-11-9-7-8-10-17-31(44-6)23-34(41)38-29-20-28(21-30(39)22-29)16-13-15-25(3)35(42)26(32)4/h7-11,15,17,20-22,24,26-27,31-32,35,39,42H,12-14,16,18-19,23H2,1-6H3,(H,37,40)(H,38,41)/t26-,27+,31-,32-,35-/m0/s1 |
| InChIKey | BKJXZBALKMPKBS-RSKSEMQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30132670) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trienomycin J (CHEBI:210289) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(5R,13S,14R,15R)-15,22-dihydroxy-5-methoxy-14,16-dimethyl-3-oxo-2-azabicyclo[18.3.1]tetracosa-1(23),6,8,10,16,20(24),21-heptaen-13-yl] (2R)-2-(5-methylhexanoylamino)propanoate |