EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | CC=Cc1cc(=O)c2c(C(=O)OC)cc(OC)c(O)c2o1 |
| InChI | InChI=1S/C15H14O6/c1-4-5-8-6-10(16)12-9(15(18)20-3)7-11(19-2)13(17)14(12)21-8/h4-7,17H,1-3H3 |
| InChIKey | OYKYSVOHYFCYHY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diaporthe (ncbitaxon:36922) | - | PubMed (32717916) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Longichromone A (CHEBI:210255) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| methyl 8-hydroxy-7-methoxy-4-oxo-2-prop-1-enylchromene-5-carboxylate |