EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CC(=CCO)CC1=C(CC(=O)O)[C@]2(C)CCC[C@@](C)(CO)[C@H]2CC1 |
| InChI | InChI=1S/C20H32O4/c1-14(7-10-21)11-15-5-6-17-19(2,13-22)8-4-9-20(17,3)16(15)12-18(23)24/h7,17,21-22H,4-6,8-13H2,1-3H3,(H,23,24)/t17-,19+,20+/m1/s1 |
| InChIKey | XUEPRWCQZSMQQY-HOJAQTOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diaporthe (ncbitaxon:36922) | - | PubMed (32717916) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Longidiacid B (CHEBI:210250) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 2-[(4aS,5R,8aR)-5-(hydroxymethyl)-2-(4-hydroxy-2-methylbut-2-enyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid |