EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O7 |
| Net Charge | 0 |
| Average Mass | 370.357 |
| Monoisotopic Mass | 370.10525 |
| SMILES | CO/C(C)=C/c1oc(C(=O)C(=O)c2ccccc2)c2c1C(=O)[C@H](O)[C@@H](O)C2 |
| InChI | InChI=1S/C20H18O7/c1-10(26-2)8-14-15-12(9-13(21)17(23)18(15)24)20(27-14)19(25)16(22)11-6-4-3-5-7-11/h3-8,13,17,21,23H,9H2,1-2H3/b10-8+/t13-,17+/m0/s1 |
| InChIKey | BYCKRSGGJOJCOA-RHPXVONCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SCSIO 11863 (ncbitaxon:1333476) | - | PubMed (31657934) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Neoenterocin B (CHEBI:210242) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 1-[(5R,6S)-5,6-dihydroxy-3-[(E)-2-methoxyprop-1-enyl]-4-oxo-6,7-dihydro-5H-2-benzouran-1-yl]-2-phenylethane-1,2-dione |