EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O2 |
| Net Charge | 0 |
| Average Mass | 334.379 |
| Monoisotopic Mass | 334.14298 |
| SMILES | Nc1ccccc1C(=O)NCC(=O)N/C=C/c1cnc2ccccc12 |
| InChI | InChI=1S/C19H18N4O2/c20-16-7-3-1-6-15(16)19(25)23-12-18(24)21-10-9-13-11-22-17-8-4-2-5-14(13)17/h1-11,22H,12,20H2,(H,21,24)(H,23,25)/b10-9+ |
| InChIKey | DCQDGRBMXXRGIN-MDZDMXLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies (ncbitaxon:5081) | - | PubMed (9528122) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penidiamide (CHEBI:210241) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-amino-N-[2-[[(E)-2-(1H-indol-3-yl)ethenyl]amino]-2-oxoethyl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 8624961 | ChemSpider |