EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O6 |
| Net Charge | 0 |
| Average Mass | 354.358 |
| Monoisotopic Mass | 354.11034 |
| SMILES | CO/C(C)=C/c1oc(C(=O)C(=O)c2ccccc2)c2c1C(=O)C[C@@H](O)C2 |
| InChI | InChI=1S/C20H18O6/c1-11(25-2)8-16-17-14(9-13(21)10-15(17)22)20(26-16)19(24)18(23)12-6-4-3-5-7-12/h3-8,13,21H,9-10H2,1-2H3/b11-8+/t13-/m0/s1 |
| InChIKey | JBIMWARAATZDME-YKWSONSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SCSIO 11863 (ncbitaxon:1333476) | - | PubMed (31657934) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Neoenterocin A (CHEBI:210236) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 1-[(6S)-6-hydroxy-3-[(E)-2-methoxyprop-1-enyl]-4-oxo-6,7-dihydro-5H-2-benzouran-1-yl]-2-phenylethane-1,2-dione |