EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18N2O5 |
| Net Charge | 0 |
| Average Mass | 390.395 |
| Monoisotopic Mass | 390.12157 |
| SMILES | O=C(O)C=CC=Cc1ccc(N=[N+]([O-])c2ccc(C=CC=CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O5/c25-21(26)7-3-1-5-17-9-13-19(14-10-17)23-24(29)20-15-11-18(12-16-20)6-2-4-8-22(27)28/h1-16H,(H,25,26)(H,27,28) |
| InChIKey | DWWFBEHZWMJBJY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (26623715) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Azoxymycin C (CHEBI:210225) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| [4-(4-carboxybuta-1,3-dienyl)phenyl]-[4-(4-carboxybuta-1,3-dienyl)phenyl]imino-oxidoazanium |