EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H41N9O9 |
| Net Charge | 0 |
| Average Mass | 671.712 |
| Monoisotopic Mass | 671.30272 |
| SMILES | NCCCC[C@@H](NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1COC(c2ccccc2O)=N1)C(=O)N[C@@H](CO)C(=O)N[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C30H41N9O9/c31-10-4-3-7-19(25(42)37-22(14-40)27(44)35-20-8-5-11-39(47)30(20)46)34-26(43)21(12-17-13-32-16-33-17)36-28(45)23-15-48-29(38-23)18-6-1-2-9-24(18)41/h1-2,6,9,13,16,19-23,40-41,47H,3-5,7-8,10-12,14-15,31H2,(H,32,33)(H,34,43)(H,35,44)(H,36,45)(H,37,42)/t19-,20+,21+,22+,23+/m1/s1 |
| InChIKey | LRVQAPVXSPHVLF-QCBQRGATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies NRRL F-4415 (ncbitaxon:1286194) | - | PubMed (23336063) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gobichelin A (CHEBI:210221) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (4S)-N-[(2S)-1-[[(2R)-6-amino-1-[[(2S)-3-hydroxy-1-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-1-oxopropan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 59702146 | ChemSpider |