EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H80N8O12 |
| Net Charge | 0 |
| Average Mass | 985.234 |
| Monoisotopic Mass | 984.58957 |
| SMILES | CCC(C)C1OC(=O)C(C)C(CC)NC(=O)C(C)NC(=O)C(C)(C)C(=O)C(C)NC(=O)C(Cc2ccc(OC)cc2)N(C)C(=O)C(C(C)C)N(C)C(=O)CNC(=O)C(C(C)CC)N(C)C(=O)CNC1=O |
| InChI | InChI=1S/C50H80N8O12/c1-17-28(6)40-45(64)51-25-37(59)57(14)39(27(4)5)47(66)56(13)36(24-33-20-22-34(69-16)23-21-33)44(63)53-31(9)42(61)50(11,12)49(68)54-32(10)43(62)55-35(19-3)30(8)48(67)70-41(29(7)18-2)46(65)52-26-38(60)58(40)15/h20-23,27-32,35-36,39-41H,17-19,24-26H2,1-16H3,(H,51,64)(H,52,65)(H,53,63)(H,54,68)(H,55,62) |
| InChIKey | KDZUJZSBNBCYEK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | DOI (10.1021/jo00176a004) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Majusculamide C (CHEBI:210215) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 2,8-di(butan-2-yl)-28-ethyl-17-[(4-methoxyphenyl)methyl]-7,13,16,20,22,22,25,29-octamethyl-14-propan-2-yl-1-oxa-4,7,10,13,16,19,24,27-octazacyclotriacontane-3,6,9,12,15,18,21,23,26,30-decone |
| Manual Xrefs | Databases |
|---|---|
| 10469608 | ChemSpider |