EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H62N6O6 |
| Net Charge | 0 |
| Average Mass | 686.939 |
| Monoisotopic Mass | 686.47308 |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC)N(C)C(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)C(=O)[C@H]([C@@H](C)CC)N(C)C(=O)[C@H](C)N(C)C(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C37H62N6O6/c1-15-24(7)30(32(44)38-10)42(13)36(48)28(22(3)4)39-33(45)29(23(5)6)41(12)37(49)31(25(8)16-2)43(14)34(46)26(9)40(11)35(47)27-20-18-17-19-21-27/h17-26,28-31H,15-16H2,1-14H3,(H,38,44)(H,39,45)/t24-,25-,26-,28-,29-,30-,31-/m0/s1 |
| InChIKey | VUIRIWVOQOHERQ-NCAIPCCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterulaspecies (ncbitaxon:2040936) | - | PubMed (17067148) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pterulamide III (CHEBI:210186) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-methyl-N-[(2S)-1-[methyl-[(2S,3S)-3-methyl-1-[methyl-[(2S)-3-methyl-1-[[(2S)-3-methyl-1-[methyl-[(2S,3S)-3-methyl-1-(methylamino)-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 17250097 | ChemSpider |