EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O6 |
| Net Charge | 0 |
| Average Mass | 330.336 |
| Monoisotopic Mass | 330.11034 |
| SMILES | CC(=O)[C@]12CC[C@H]3[C@H](CO[C@]34c3c(O)ccc(O)c3C(=O)[C@H]14)[C@H]2O |
| InChI | InChI=1S/C18H18O6/c1-7(19)17-5-4-9-8(16(17)23)6-24-18(9)13-11(21)3-2-10(20)12(13)14(22)15(17)18/h2-3,8-9,15-16,20-21,23H,4-6H2,1H3/t8-,9-,15+,16+,17+,18-/m0/s1 |
| InChIKey | AGUVWXMXJZLVKP-MBKRRSCOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | - | PubMed (31556302) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-lucidumone (CHEBI:210181) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (1R,2R,10R,13R,14S,17R)-1-acetyl-5,8,17-trihydroxy-11-oxapentacyclo[11.3.1.02,10.04,9.010,14]heptadeca-4,6,8-trien-3-one |