EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO5 |
| Net Charge | 0 |
| Average Mass | 265.265 |
| Monoisotopic Mass | 265.09502 |
| SMILES | C[C@@H]1OC(c2ccccc2O)=N[C@H]1[C@H](O)CC(=O)O |
| InChI | InChI=1S/C13H15NO5/c1-7-12(10(16)6-11(17)18)14-13(19-7)8-4-2-3-5-9(8)15/h2-5,7,10,12,15-16H,6H2,1H3,(H,17,18)/t7-,10+,12+/m0/s1 |
| InChIKey | HYNVCGWXNJDHLB-HNBZJPLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leptolyngbyaspecies (ncbitaxon:47254) | - | PubMed (31591889) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leptazoline C (CHEBI:210164) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-3-[(4S,5S)-2-(2-hydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]propanoic acid |