EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15ClO6 |
| Net Charge | 0 |
| Average Mass | 410.809 |
| Monoisotopic Mass | 410.05572 |
| SMILES | Cc1cc(=O)c2c(O)c3c(O)cc(=O)c4c3c3c(c(Cl)c(O)c1c23)C(C)(C)C=4O |
| InChI | InChI=1S/C22H15ClO6/c1-6-4-7(24)11-14-10(6)20(28)18(23)17-16(14)15-12(19(11)27)8(25)5-9(26)13(15)21(29)22(17,2)3/h4-5,25,27-29H,1-3H3 |
| InChIKey | XPRNISGCKLGFQQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillusspecies (in: firmicutes) (ncbitaxon:1409) | - | PubMed (12147512) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorxanthomycin (CHEBI:210147) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 7-chloro-6,10,14,19-tetrahydroxy-4,9,9-trimethylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(19),3,5(18),6,8(17),10,13,15-octaene-2,12-dione |
| Manual Xrefs | Databases |
|---|---|
| 78435408 | ChemSpider |