EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O5 |
| Net Charge | 0 |
| Average Mass | 308.374 |
| Monoisotopic Mass | 308.16237 |
| SMILES | C[C@H]1CCC/C=C\[C@@H]2C[C@H](OC=O)C[C@H]2[C@H](O)/C=C\C(=O)O1 |
| InChI | InChI=1S/C17H24O5/c1-12-5-3-2-4-6-13-9-14(21-11-18)10-15(13)16(19)7-8-17(20)22-12/h4,6-8,11-16,19H,2-3,5,9-10H2,1H3/b6-4-,8-7-/t12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | FYSPUNXLASVJRH-MILRXXLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (19177238) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brefeldin A formylate (CHEBI:210144) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(1R,2R,3Z,7S,11Z,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] ormate |
| Manual Xrefs | Databases |
|---|---|
| 78441303 | ChemSpider |