EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2O5S2 |
| Net Charge | 0 |
| Average Mass | 428.491 |
| Monoisotopic Mass | 428.05006 |
| SMILES | CC(=O)O[C@H]1C=COC=C2C[C@@]34SS[C@]5(Cc6ccccc6N5C3=O)C(=O)N4[C@@H]21 |
| InChI | InChI=1S/C20H16N2O5S2/c1-11(23)27-15-6-7-26-10-13-9-20-17(24)21-14-5-3-2-4-12(14)8-19(21,28-29-20)18(25)22(20)16(13)15/h2-7,10,15-16H,8-9H2,1H3/t15-,16-,19+,20+/m0/s1 |
| InChIKey | NUWJPBORJRNCDP-XAMWDVODSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies KMD 901 (ncbitaxon:658537) | - | PubMed (21122037) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deoxyapoaranotin (CHEBI:210109) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| [(1R,4S,5S,12R)-2,13-dioxo-8-oxa-22,23-dithia-3,14-diazahexacyclo[10.9.2.01,14.03,12.04,10.015,20]tricosa-6,9,15,17,19-pentaen-5-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 27022859 | ChemSpider |