EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22N2O7 |
| Net Charge | 0 |
| Average Mass | 438.436 |
| Monoisotopic Mass | 438.14270 |
| SMILES | C[C@H]1C(=O)NC2=CC(=O)C=C(C2=O)[C@@H](Nc2cc(O)cc(C(=O)O)c2)C/C=C/C=C/[C@H]1O |
| InChI | InChI=1S/C23H22N2O7/c1-12-20(28)6-4-2-3-5-18(24-14-7-13(23(31)32)8-15(26)9-14)17-10-16(27)11-19(21(17)29)25-22(12)30/h2-4,6-12,18,20,24,26,28H,5H2,1H3,(H,25,30)(H,31,32)/b3-2+,6-4+/t12-,18+,20-/m1/s1 |
| InChIKey | HNKVTOIDORZILO-OQJWUKIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies S35 (ncbitaxon:1456732) | - | PubMed (31525059) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aminoansamycin G (CHEBI:210090) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[[(4R,5R,6E,8E,11S)-5-hydroxy-4-methyl-3,14,16-trioxo-2-azabicyclo[10.3.1]hexadeca-1(15),6,8,12-tetraen-11-yl]amino]benzoic acid |