EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N2O6 |
| Net Charge | 0 |
| Average Mass | 424.453 |
| Monoisotopic Mass | 424.16344 |
| SMILES | C[C@H]1C(=O)Nc2cc(O)cc(c2O)[C@@H](Nc2ccccc2C(=O)O)C/C=C/C=C/[C@H]1O |
| InChI | InChI=1S/C23H24N2O6/c1-13-20(27)10-4-2-3-8-18(24-17-9-6-5-7-15(17)23(30)31)16-11-14(26)12-19(21(16)28)25-22(13)29/h2-7,9-13,18,20,24,26-28H,8H2,1H3,(H,25,29)(H,30,31)/b3-2+,10-4+/t13-,18+,20-/m1/s1 |
| InChIKey | OWDJOZOLRGWRFL-VFIWSIKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies S35 (ncbitaxon:1456732) | - | PubMed (31525059) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aminoansamycin D (CHEBI:210071) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-[[(4R,5R,6E,8E,11S)-5,14,16-trihydroxy-4-methyl-3-oxo-2-azabicyclo[10.3.1]hexadeca-1(15),6,8,12(16),13-pentaen-11-yl]amino]benzoic acid |