EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O9 |
| Net Charge | 0 |
| Average Mass | 600.749 |
| Monoisotopic Mass | 600.32983 |
| SMILES | C[C@@H]1C[C@]2(OC[C@]34[C@H](O)CC5=C(C(=O)C[C@H]6C(C)(C)[C@H](OC(=O)CC(=O)O)CC[C@]56C)[C@]3(C)CC[C@H]14)OC(=O)[C@@H](C)[C@@H]2C |
| InChI | InChI=1S/C34H48O9/c1-17-15-34(19(3)18(2)29(40)43-34)41-16-33-20(17)8-11-32(33,7)28-21(12-24(33)36)31(6)10-9-25(42-27(39)14-26(37)38)30(4,5)23(31)13-22(28)35/h17-20,23-25,36H,8-16H2,1-7H3,(H,37,38)/t17-,18+,19+,20-,23+,24-,25-,31-,32+,33+,34+/m1/s1 |
| InChIKey | JVTKEEUUSBPFFJ-NGPOTDMGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fomes (ncbitaxon:40441) | - | PubMed (27216472) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Officimalonic acid C (CHEBI:210070) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 3-[(1R,2R,3'S,4'S,5S,8R,10R,14R,17R,18R,20S)-2-hydroxy-3',4',5,9,9,14,18-heptamethyl-5',12-dioxospiro[21-oxapentacyclo[12.8.0.01,17.04,13.05,10]docos-4(13)-ene-20,2'-oxolane]-8-yl]oxy-3-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443427 | ChemSpider |