EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O6 |
| Net Charge | 0 |
| Average Mass | 294.303 |
| Monoisotopic Mass | 294.11034 |
| SMILES | CCC[C@@H]1C[C@H]2OC(=O)c3c(cc(O)c(OC)c3O)[C@@H]2O1 |
| InChI | InChI=1S/C15H18O6/c1-3-4-7-5-10-13(20-7)8-6-9(16)14(19-2)12(17)11(8)15(18)21-10/h6-7,10,13,16-17H,3-5H2,1-2H3/t7-,10-,13+/m1/s1 |
| InChIKey | ZXWQOPCWRZRWHP-OHILOLKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Exserohilum (ncbitaxon:91493) | - | PubMed (30091601) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Exserolide K (CHEBI:210063) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (2R,3aR,9bS)-6,8-dihydroxy-7-methoxy-2-propyl-2,3,3a,9b-tetrahydrouro[3,2-c]isochromen-5-one |
| Manual Xrefs | Databases |
|---|---|
| 71044425 | ChemSpider |