EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H41N7O9 |
| Net Charge | 0 |
| Average Mass | 631.687 |
| Monoisotopic Mass | 631.29658 |
| SMILES | CN1[C@H](CCCN(O)C(=O)CCNC(=O)CNC(=O)[C@@H]2COC(c3ccccc3O)=N2)C(=O)N([C@@H]2CCCN(O)C2=O)C1(C)C |
| InChI | InChI=1S/C29H41N7O9/c1-29(2)33(3)20(28(42)36(29)21-10-7-15-35(44)27(21)41)9-6-14-34(43)24(39)12-13-30-23(38)16-31-25(40)19-17-45-26(32-19)18-8-4-5-11-22(18)37/h4-5,8,11,19-21,37,43-44H,6-7,9-10,12-17H2,1-3H3,(H,30,38)(H,31,40)/t19-,20+,21+/m0/s1 |
| InChIKey | JYFWTXBQPCKDEP-PWRODBHTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies (ncbitaxon:1989) | - | PubMed (31380646) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin D2 (CHEBI:209996) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (4S)-N-[2-[[3-[hydroxy-[3-[(4R)-1-[(3R)-1-hydroxy-2-oxopiperidin-3-yl]-2,2,3-trimethyl-5-oxoimidazolidin-4-yl]propyl]amino]-3-oxopropyl]amino]-2-oxoethyl]-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |