EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N7O9 |
| Net Charge | 0 |
| Average Mass | 617.660 |
| Monoisotopic Mass | 617.28093 |
| SMILES | C[C@@H]1N(C)[C@H](CCCN(O)C(=O)CCNC(=O)CNC(=O)[C@@H]2COC(c3ccccc3O)=N2)C(=O)N1[C@@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C28H39N7O9/c1-17-32(2)20(28(41)35(17)21-9-6-14-34(43)27(21)40)8-5-13-33(42)24(38)11-12-29-23(37)15-30-25(39)19-16-44-26(31-19)18-7-3-4-10-22(18)36/h3-4,7,10,17,19-21,36,42-43H,5-6,8-9,11-16H2,1-2H3,(H,29,37)(H,30,39)/t17-,19+,20-,21-/m1/s1 |
| InChIKey | IJNYAEKIBWVLEZ-GFOJFJKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies (ncbitaxon:1989) | - | PubMed (31380646) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin D1 (CHEBI:209990) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (4S)-N-[2-[[3-[hydroxy-[3-[(2R,4R)-1-[(3R)-1-hydroxy-2-oxopiperidin-3-yl]-2,3-dimethyl-5-oxoimidazolidin-4-yl]propyl]amino]-3-oxopropyl]amino]-2-oxoethyl]-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |