EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O6 |
| Net Charge | 0 |
| Average Mass | 476.654 |
| Monoisotopic Mass | 476.31379 |
| SMILES | C[C@H]1[C@H]([C@@H](O)[C@@](C)(O)[C@H]2CC[C@@]3(O)C4=CC(=O)[C@@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)OC[C@@H]1C |
| InChI | InChI=1S/C28H44O6/c1-15-14-34-23(16(15)2)24(31)27(5,32)22-8-11-28(33)19-13-21(30)20-12-17(29)6-9-25(20,3)18(19)7-10-26(22,28)4/h13,15-18,20,22-24,29,31-33H,6-12,14H2,1-5H3/t15-,16+,17-,18-,20-,22-,23+,24+,25+,26+,27-,28+/m0/s1 |
| InChIKey | FBQJWZJYUOWAOR-UBTGPEGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polyporus umbellatus (ncbitaxon:158314) | - | PubMed (17666835) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (23R,24R,25R)-23,26-epoxy-3beta,14alpha,21alpha,22alpha-tetrahydroxyergost-7-en-6-one (CHEBI:209975) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3S,5R,9R,10R,13R,14S,17S)-17-[(1R,2S)-1-[(2R,3R,4R)-3,4-dimethyloxolan-2-yl]-1,2-dihydroxypropan-2-yl]-3,14-dihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| Manual Xrefs | Databases |
|---|---|
| 78441095 | ChemSpider |