EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33ClO5 |
| Net Charge | 0 |
| Average Mass | 460.998 |
| Monoisotopic Mass | 460.20165 |
| SMILES | CC1=CCCC(C)(C)[C@@H]1CC(C[C@@]1(O)C(=O)c2cc(O)cc(O)c2C(=O)[C@@]1(C)Cl)=C(C)C |
| InChI | InChI=1S/C26H33ClO5/c1-14(2)16(10-19-15(3)8-7-9-24(19,4)5)13-26(32)22(30)18-11-17(28)12-20(29)21(18)23(31)25(26,6)27/h8,11-12,19,28-29,32H,7,9-10,13H2,1-6H3/t19-,25-,26-/m1/s1 |
| InChIKey | QYGRDYUHWNHSEG-WGURPXDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (31298867) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Merochlorin E (CHEBI:209932) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| (2R,3S)-3-chloro-2,5,7-trihydroxy-3-methyl-2-[3-methyl-2-[[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]methyl]but-2-enyl]naphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 77001836 | ChemSpider |