EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8N2OS |
| Net Charge | 0 |
| Average Mass | 228.276 |
| Monoisotopic Mass | 228.03573 |
| SMILES | O=C(c1nccs1)c1cnc2ccccc12 |
| InChI | InChI=1S/C12H8N2OS/c15-11(12-13-5-6-16-12)9-7-14-10-4-2-1-3-8(9)10/h1-7,14H |
| InChIKey | DFYPIVYFSGGXGT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoplanes capillaceus (ncbitaxon:76756) | - | PubMed (24697522) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indothiazinone (CHEBI:209925) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 1H-indol-3-yl(1,3-thiazol-2-yl)methanone |
| Manual Xrefs | Databases |
|---|---|
| 32033781 | ChemSpider |