EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O3 |
| Net Charge | 0 |
| Average Mass | 322.364 |
| Monoisotopic Mass | 322.13174 |
| SMILES | O=C(Cc1ccccc1)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H18N2O3/c22-18(10-13-6-2-1-3-7-13)21-17(19(23)24)11-14-12-20-16-9-5-4-8-15(14)16/h1-9,12,17,20H,10-11H2,(H,21,22)(H,23,24)/t17-/m0/s1 |
| InChIKey | NSQNLGGXYKEPQJ-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1002/hlca.201100104) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Phenylacetyl-L-tryptophan (CHEBI:209918) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-[(2-phenylacetyl)amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24977530 | ChemSpider |