EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N4O7 |
| Net Charge | 0 |
| Average Mass | 472.498 |
| Monoisotopic Mass | 472.19580 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)NCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H28N4O7/c24-18(11-14-1-5-16(28)6-2-14)22(32)26-13-21(31)25-10-9-20(30)27-19(23(33)34)12-15-3-7-17(29)8-4-15/h1-8,18-19,28-29H,9-13,24H2,(H,25,31)(H,26,32)(H,27,30)(H,33,34)/t18-,19-/m0/s1 |
| InChIKey | LXEAVZVGZUWFGQ-OALUTQOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jahnella thaxteri (ncbitaxon:889265) | - | PubMed (31184172) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thaxteramide D (CHEBI:209875) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[3-[[2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]propanoylamino]-3-(4-hydroxyphenyl)propanoic acid |