EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O7S2 |
| Net Charge | 0 |
| Average Mass | 454.526 |
| Monoisotopic Mass | 454.08684 |
| SMILES | CO[C@@H]1CC(=O)[C@@H]2C[C@@]34SS[C@]5(C[C@H]6C(=O)CC[C@H](O)[C@H]6N5C3=O)C(=O)N4[C@@H]2[C@H]1O |
| InChI | InChI=1S/C19H22N2O7S2/c1-28-12-4-11(24)8-6-19-16(26)20-13-7(9(22)2-3-10(13)23)5-18(20,29-30-19)17(27)21(19)14(8)15(12)25/h7-8,10,12-15,23,25H,2-6H2,1H3/t7-,8-,10-,12+,13-,14-,15-,18+,19+/m0/s1 |
| InChIKey | DYPZSJAFJARDLC-FVCPCXLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epicoccum (ncbitaxon:104397) | - | PubMed (32183021) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7'-demethoxyrostratin C (CHEBI:209873) is a 2,5-diketopiperazines (CHEBI:65061) |
| 7'-demethoxyrostratin C (CHEBI:209873) is a indoles (CHEBI:24828) |
| 7'-demethoxyrostratin C (CHEBI:209873) is a organic disulfide (CHEBI:35489) |
| 7'-demethoxyrostratin C (CHEBI:209873) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1R,4S,5R,6R,9R,11R,14S,15S,19R)-5,15-dihydroxy-6-methoxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docosane-2,8,12,18-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 81424681 | ChemSpider |