EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H55N7O10 |
| Net Charge | 0 |
| Average Mass | 781.908 |
| Monoisotopic Mass | 781.40104 |
| SMILES | CC=C(C)CCCC(C)C(N)CC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)NCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C39H55N7O10/c1-4-23(2)6-5-7-24(3)29(40)20-35(51)44-31(21-33(41)49)38(54)46-30(18-25-8-12-27(47)13-9-25)37(53)43-22-36(52)42-17-16-34(50)45-32(39(55)56)19-26-10-14-28(48)15-11-26/h4,8-15,24,29-32,47-48H,5-7,16-22,40H2,1-3H3,(H2,41,49)(H,42,52)(H,43,53)(H,44,51)(H,45,50)(H,46,54)(H,55,56)/t24?,29?,30-,31-,32-/m0/s1 |
| InChIKey | OCTHNVHQFJPSTK-GEWXTNJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jahnella thaxteri (ncbitaxon:889265) | - | PubMed (31184172) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thaxteramide C (CHEBI:209869) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[3-[[2-[[(2S)-2-[[(2S)-4-amino-2-[(3-amino-4,8-dimethyldec-8-enoyl)amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]propanoylamino]-3-(4-hydroxyphenyl)propanoic acid |