EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO4 |
| Net Charge | 0 |
| Average Mass | 185.179 |
| Monoisotopic Mass | 185.06881 |
| SMILES | C=C(NC(C)=O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C8H11NO4/c1-5(9-6(2)10)7(11)3-4-8(12)13/h1,3-4H2,2H3,(H,9,10)(H,12,13) |
| InChIKey | JRLAQUJSYKXZFV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies A012304 (ncbitaxon:375446) | - | PubMed (16195590) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alaremycin (CHEBI:209839) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 5-acetamido-4-oxohex-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9890019 | ChemSpider |