EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O8 |
| Net Charge | 0 |
| Average Mass | 210.138 |
| Monoisotopic Mass | 210.03757 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O |
| WURCS | WURCS=2.0/1,1,0/[A2122A]/1/ |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 |
| InChIKey | DSLZVSRJTYRBFB-LLEIAEIESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucaric acid (CHEBI:16002) has role antineoplastic agent (CHEBI:35610) |
| D-glucaric acid (CHEBI:16002) is a glucaric acid (CHEBI:17301) |
| D-glucaric acid (CHEBI:16002) is conjugate acid of D-glucarate(1−) (CHEBI:33801) |
| D-glucaric acid (CHEBI:16002) is enantiomer of L-glucaric acid (CHEBI:47537) |
| Incoming Relation(s) |
| D-glucaro-1,5-lactone (CHEBI:84191) has functional parent D-glucaric acid (CHEBI:16002) |
| 2-dehydro-3-deoxy-D-glucaric acid (CHEBI:17305) has functional parent D-glucaric acid (CHEBI:16002) |
| 5-dehydro-4-deoxy-D-glucaric acid (CHEBI:16369) has functional parent D-glucaric acid (CHEBI:16002) |
| D-glucarate(1−) (CHEBI:33801) is conjugate base of D-glucaric acid (CHEBI:16002) |
| L-glucaric acid (CHEBI:47537) is enantiomer of D-glucaric acid (CHEBI:16002) |
| IUPAC Names |
|---|
| (2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioic acid |
| D-glucaric acid |
| Synonyms | Source |
|---|---|
| D-glucaric acid | ChEBI |
| D-Glucaric acid | KEGG COMPOUND |
| D-Glucosaccharic acid | KEGG COMPOUND |
| D-Saccharic acid | KEGG COMPOUND |
| Glucaric acid | KEGG COMPOUND |
| L-Gularic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00818 | KEGG COMPOUND |
| D-GLUCARATE | MetaCyc |
| HMDB0029881 | HMDB |
| Saccharic_acid | Wikipedia |
| Citations |
|---|