EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | Cc1c(O)cc(O)c2c1[C@](C)(O)[C@H](C)OC2=O |
| InChI | InChI=1S/C12H14O5/c1-5-7(13)4-8(14)9-10(5)12(3,16)6(2)17-11(9)15/h4,6,13-14,16H,1-3H3/t6-,12+/m0/s1 |
| InChIKey | XNVSHNAIBWZKBZ-PWCHPLFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus banksianus (ncbitaxon:2175282) | - | PubMed (29920099) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Banksialactone C (CHEBI:209818) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S,4S)-4,6,8-trihydroxy-3,4,5-trimethyl-3H-isochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78439095 | ChemSpider |