EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O7S2 |
| Net Charge | 0 |
| Average Mass | 427.460 |
| Monoisotopic Mass | 427.05079 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)O)N1C(=O)[C@]2(NC(=O)Cc1cccs1)OC |
| InChI | InChI=1S/C16H17N3O7S2/c1-25-16(18-10(20)5-9-3-2-4-27-9)13(23)19-11(12(21)22)8(6-26-15(17)24)7-28-14(16)19/h2-4,14H,5-7H2,1H3,(H2,17,24)(H,18,20)(H,21,22)/t14-,16+/m1/s1 |
| InChIKey | WZOZEZRFJCJXNZ-ZBFHGGJFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefoxitin (CHEBI:209807) has role antibacterial drug (CHEBI:36047) |
| cefoxitin (CHEBI:209807) is a cephalosporin (CHEBI:23066) |
| cefoxitin (CHEBI:209807) is a cephamycin (CHEBI:55429) |
| cefoxitin (CHEBI:209807) is a semisynthetic derivative (CHEBI:72588) |
| cefoxitin (CHEBI:209807) is a β-lactam antibiotic allergen (CHEBI:88225) |
| cefoxitin (CHEBI:209807) is conjugate acid of cefoxitin(1−) (CHEBI:53655) |
| Incoming Relation(s) |
| cefoxitin(1−) (CHEBI:53655) is conjugate base of cefoxitin (CHEBI:209807) |
| IUPAC Names |
|---|
| 3-[(carbamoyloxy)methyl]-7α-methoxy-7β-[(thiophen-2-yl)acetamido]-3,4-didehydrocepham-4-carboxylic acid |
| (6R,7S)-4-[(carbamoyloxy)methyl]-7-methoxy-8-oxo-7-[(thiophen-2-enyl)acetamido]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| cefoxitin | KEGG DRUG |
| cefoxitina | ChemIDplus |
| cefoxitine | ChemIDplus |
| cefoxitinum | ChemIDplus |
| ceftoxitin | ChemIDplus |
| Synonyms | Source |
|---|---|
| CFX | KEGG DRUG |
| (6R,7S)-3-[(carbamoyloxy)methyl]-7-methoxy-8-oxo-7-[(2-thienylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Cefoxitin | ChemIDplus |
| Cephoxitin | ChemIDplus |
| Rephoxitin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4216947 | Beilstein |
| Reaxys:4216947 | Reaxys |
| CAS:35607-66-0 | KEGG COMPOUND |
| CAS:35607-66-0 | ChemIDplus |
| Citations |
|---|