EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40N6O8 |
| Net Charge | 0 |
| Average Mass | 612.684 |
| Monoisotopic Mass | 612.29076 |
| SMILES | NC(N)=NCCCC(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](CCc1ccc(O)cc1)NC(=O)[C@H](O)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C30H40N6O8/c31-30(32)33-15-1-3-23(29(43)44)35-26(40)24-4-2-16-36(24)28(42)22(14-9-18-5-10-20(37)11-6-18)34-27(41)25(39)17-19-7-12-21(38)13-8-19/h5-8,10-13,22-25,37-39H,1-4,9,14-17H2,(H,34,41)(H,35,40)(H,43,44)(H4,31,32,33)/t22-,23?,24+,25-/m1/s1 |
| InChIKey | JCBBIZWYSLCGPJ-ZTRUVXPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena AV1 (ncbitaxon:284707) | - | DOI (10.1016/s0040-4039(97)01192-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spumigin C (CHEBI:209794) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 64868960 | ChemSpider |