EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O6 |
| Net Charge | 0 |
| Average Mass | 264.233 |
| Monoisotopic Mass | 264.06339 |
| SMILES | C=C1c2c(C=O)c(O)c(C)c(O)c2C(=O)O[C@@H]1CO |
| InChI | InChI=1S/C13H12O6/c1-5-8(4-15)19-13(18)10-9(5)7(3-14)11(16)6(2)12(10)17/h3,8,15-17H,1,4H2,2H3/t8-/m1/s1 |
| InChIKey | RXRBOGXHNSIECJ-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsisspecies (ncbitaxon:36460) | - | PubMed (31033302) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxopestalochromane (CHEBI:209727) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S)-6,8-dihydroxy-3-(hydroxymethyl)-7-methyl-4-methylidene-1-oxoisochromene-5-carbaldehyde |