EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37NO2 |
| Net Charge | 0 |
| Average Mass | 347.543 |
| Monoisotopic Mass | 347.28243 |
| SMILES | CC[C@@H](C)C[C@@H](C)C=CCC[C@@H](O)[C@H](Cc1ccc(O)cc1)N(C)C |
| InChI | InChI=1S/C22H37NO2/c1-6-17(2)15-18(3)9-7-8-10-22(25)21(23(4)5)16-19-11-13-20(24)14-12-19/h7,9,11-14,17-18,21-22,24-25H,6,8,10,15-16H2,1-5H3/t17-,18+,21+,22-/m1/s1 |
| InChIKey | KUPOHNLIXOKKCF-JZZBYWGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudallescheria (ncbitaxon:5596) | - | PubMed (23627396) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyltyroscherin (CHEBI:209723) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 4-[(2S,3R,8R,10R)-2-(dimethylamino)-3-hydroxy-8,10-dimethyldodec-6-enyl]phenol |
| Manual Xrefs | Databases |
|---|---|
| 78438481 | ChemSpider |