EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O5 |
| Net Charge | 0 |
| Average Mass | 336.343 |
| Monoisotopic Mass | 336.09977 |
| SMILES | O=C1C[C@H]2[C@H]3CCC(=O)c4c(O)ccc(c43)[C@@]2(O)c2cccc(O)c21 |
| InChI | InChI=1S/C20H16O5/c21-13-3-1-2-10-18(13)16(24)8-12-9-4-6-14(22)19-15(23)7-5-11(17(9)19)20(10,12)25/h1-3,5,7,9,12,21,23,25H,4,6,8H2/t9-,12+,20+/m1/s1 |
| InChIKey | OYRYUFABCKQXTO-HGCCHXFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daldiniaspecies (ncbitaxon:1769485) | - | PubMed (12502330) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Daldinone A (CHEBI:209670) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (2R,11S,12R)-2,7,17-trihydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(20),3(8),4,6,16,18-hexaene-9,15-dione |
| Manual Xrefs | Databases |
|---|---|
| 552719 | ChemSpider |