EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O2 |
| Net Charge | 0 |
| Average Mass | 304.389 |
| Monoisotopic Mass | 304.14633 |
| SMILES | CO[C@@H]1CCc2c3c4c(c(O)ccc4c4cccc1c24)CCC3 |
| InChI | InChI=1S/C21H20O2/c1-23-19-11-9-15-12-4-2-6-16-18(22)10-8-14(20(12)16)13-5-3-7-17(19)21(13)15/h3,5,7-8,10,19,22H,2,4,6,9,11H2,1H3/t19-/m1/s1 |
| InChIKey | GJBSMXDYKVJOSZ-LJQANCHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium (ncbitaxon:5498) | - | PubMed (31963874) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altertoxin XI (CHEBI:209619) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (9R)-9-methoxy-4,5,6,7,8,9-hexahydroperylen-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 81367025 | ChemSpider |