EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O2 |
| Net Charge | 0 |
| Average Mass | 290.362 |
| Monoisotopic Mass | 290.13068 |
| SMILES | Oc1ccc2c3c1CCCc3c1c3c(cccc32)[C@H](O)CC1 |
| InChI | InChI=1S/C20H18O2/c21-17-9-8-14-12-4-2-6-16-18(22)10-7-13(20(12)16)11-3-1-5-15(17)19(11)14/h1,3,5,7,10,17,21-22H,2,4,6,8-9H2/t17-/m1/s1 |
| InChIKey | GVTNCLLILDBBLI-QGZVFWFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium (ncbitaxon:5498) | - | PubMed (31963874) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altertoxin IX (CHEBI:209608) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (3R)-1,2,3,10,11,12-hexahydroperylene-3,9-diol |
| Manual Xrefs | Databases |
|---|---|
| 81367023 | ChemSpider |