EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O3 |
| Net Charge | 0 |
| Average Mass | 304.345 |
| Monoisotopic Mass | 304.10994 |
| SMILES | O=C1CCc2c3c4c(cccc4c4ccc(O)c1c24)[C@H](O)CC3 |
| InChI | InChI=1S/C20H16O3/c21-15-7-4-11-13-6-9-17(23)20-16(22)8-5-12(19(13)20)10-2-1-3-14(15)18(10)11/h1-3,5,8,15,21-22H,4,6-7,9H2/t15-/m1/s1 |
| InChIKey | KCFGYWJEICTAEX-OAHLLOKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium (ncbitaxon:5498) | - | PubMed (31963874) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altertoxin VIII (CHEBI:209601) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (10R)-4,10-dihydroxy-2,10,11,12-tetrahydro-1H-perylen-3-one |
| Manual Xrefs | Databases |
|---|---|
| 81367022 | ChemSpider |