EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35N3O5 |
| Net Charge | 0 |
| Average Mass | 433.549 |
| Monoisotopic Mass | 433.25767 |
| SMILES | CC(=O)NC(C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)O)C(C)C |
| InChI | InChI=1S/C23H35N3O5/c1-14(2)12-18(23(30)31)25-21(28)19(13-17-10-8-7-9-11-17)26(6)22(29)20(15(3)4)24-16(5)27/h7-11,14-15,18-20H,12-13H2,1-6H3,(H,24,27)(H,25,28)(H,30,31)/t18-,19+,20?/m0/s1 |
| InChIKey | OAPXADPUGXUVNF-ABZYKWASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Simplicillium (ncbitaxon:292631) | - | DOI (10.1016/j.tet.2016.04.032) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Simplicilliumtide F (CHEBI:209571) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-[(2-acetamido-3-methylbutanoyl)-methylamino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196801 | ChemSpider |