EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO3 |
| Net Charge | 0 |
| Average Mass | 229.235 |
| Monoisotopic Mass | 229.07389 |
| SMILES | O=C(O)c1ccc([C@H](O)c2ccccc2)cn1 |
| InChI | InChI=1S/C13H11NO3/c15-12(9-4-2-1-3-5-9)10-6-7-11(13(16)17)14-8-10/h1-8,12,15H,(H,16,17)/t12-/m1/s1 |
| InChIKey | BMTGCDDXYNEVRV-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Akanthomyces lecanii (ncbitaxon:2714763) | - | DOI (10.1021/np000094q) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vertilecanin A (CHEBI:209555) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| 5-[(R)-hydroxy(phenyl)methyl]pyridine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8438680 | ChemSpider |