EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H52N6O5 |
| Net Charge | 0 |
| Average Mass | 624.827 |
| Monoisotopic Mass | 624.39992 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](Cc2cnc3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C34H52N6O5/c1-18(2)13-25-30(41)37-27(15-20(5)6)33(44)40-29(21(7)8)34(45)39-26(14-19(3)4)31(42)38-28(32(43)36-25)16-22-17-35-24-12-10-9-11-23(22)24/h9-12,17-21,25-29,35H,13-16H2,1-8H3,(H,36,43)(H,37,41)(H,38,42)(H,39,45)(H,40,44)/t25-,26+,27+,28-,29-/m1/s1 |
| InChIKey | QEHZCKJTAZEKKB-JYJZCUDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mortierella alpina (ncbitaxon:64518) | - | PubMed (30789272) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malpibaldin B (CHEBI:209536) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3R,6S,9R,12S,15R)-3-(1H-indol-3-ylmethyl)-6,12,15-tris(2-methylpropyl)-9-propan-2-yl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |