EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O7 |
| Net Charge | 0 |
| Average Mass | 442.508 |
| Monoisotopic Mass | 442.19915 |
| SMILES | C=C(C)C(O)CCC(C)=CC[C@@]12OC(C)(C)[C@@H](O)C=C1C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C25H30O7/c1-13(2)18(27)7-6-14(3)8-9-25-17(12-20(29)24(4,5)32-25)22(30)21-16(23(25)31)10-15(26)11-19(21)28/h8,10-12,18,20,26-29H,1,6-7,9H2,2-5H3/t18?,20-,25+/m0/s1 |
| InChIKey | BPLKXUXDARUPCB-MNISZPLNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (31888028) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Napyradiomycin A3 (CHEBI:209527) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| (3S,10aR)-3,6,8-trihydroxy-10a-(6-hydroxy-3,7-dimethylocta-2,7-dienyl)-2,2-dimethyl-3H-benzo[g]chromene-5,10-dione |