EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H22O9 |
| Net Charge | 0 |
| Average Mass | 514.486 |
| Monoisotopic Mass | 514.12638 |
| SMILES | COc1cc(O)c2c(c1)[C@]13Oc4c(O)cc(C)c5c4c1c(c1c(O)cc(OC)cc15)C(=O)C[C@]3(C)OC2=O |
| InChI | InChI=1S/C29H22O9/c1-11-5-18(32)26-24-20(11)14-6-12(35-3)8-16(30)21(14)23-19(33)10-28(2)29(37-26,25(23)24)15-7-13(36-4)9-17(31)22(15)27(34)38-28/h5-9,30-32H,10H2,1-4H3/t28-,29-/m0/s1 |
| InChIKey | IPNAQEZMGBNQHS-VMPREFPWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternariaspecies MG1 (ncbitaxon:1678846) | - | PubMed (30789736) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-alternamgin (CHEBI:209507) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (1S,10S)-6,15,23-trihydroxy-4,17-dimethoxy-10,21-dimethyl-9,27-dioxaheptacyclo[22.2.1.01,10.02,7.013,26.014,19.020,25]heptacosa-2(7),3,5,13,15,17,19,21,23,25-decaene-8,12-dione |