EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44N6O13 |
| Net Charge | 0 |
| Average Mass | 720.733 |
| Monoisotopic Mass | 720.29664 |
| SMILES | NCCCC[C@@H](NC(=O)c1cccc(O)c1O)C(=O)N[C@@H](COC(=O)[C@H](CO)NC(=O)[C@@H](CCCCN)NC(=O)c1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C32H44N6O13/c33-13-3-1-9-19(35-27(44)17-7-5-11-23(40)25(17)42)29(46)37-21(15-39)32(50)51-16-22(31(48)49)38-30(47)20(10-2-4-14-34)36-28(45)18-8-6-12-24(41)26(18)43/h5-8,11-12,19-22,39-43H,1-4,9-10,13-16,33-34H2,(H,35,44)(H,36,45)(H,37,46)(H,38,47)(H,48,49)/t19-,20-,21+,22+/m1/s1 |
| InChIKey | NQNOYRJMWKVMTO-CZYKHXBRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dickeya chrysanthemi (ncbitaxon:556) | - | PubMed (21545171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dichrysobactin (CHEBI:209447) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-6-amino-2-[(2,3-dihydroxybenzoyl)amino]hexanoyl]amino]-3-[(2S)-2-[[(2R)-6-amino-2-[(2,3-dihydroxybenzoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437393 | ChemSpider |