EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O8 |
| Net Charge | 0 |
| Average Mass | 526.626 |
| Monoisotopic Mass | 526.25667 |
| SMILES | CC(CC(=O)CC(C)(O)C1=CC(=O)[C@]2(C)[C@]1(C)C(=O)C=C1[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3C[C@H]3O[C@@]132)C(=O)O |
| InChI | InChI=1S/C30H38O8/c1-15(24(35)36)10-16(31)14-27(5,37)19-12-22(34)29(7)28(19,6)21(33)11-18-26(4)9-8-20(32)25(2,3)17(26)13-23-30(18,29)38-23/h11-12,15,17,23,37H,8-10,13-14H2,1-7H3,(H,35,36)/t15?,17-,23+,26-,27?,28-,29+,30-/m0/s1 |
| InChIKey | LZUGLYPIDYYQJP-YUVIQOKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma annulare (ncbitaxon:1200333) | - | DOI (10.1016/0031-9422(91)83476-2) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Applanoxidic acid B (CHEBI:209415) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| 6-hydroxy-2-methyl-4-oxo-6-[(1R,3R,5R,10S,14R,18R)-6,6,10,14,18-pentamethyl-7,13,17-trioxo-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadeca-11,15-dien-15-yl]heptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8431815 | ChemSpider |