EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O6S2 |
| Net Charge | 0 |
| Average Mass | 422.484 |
| Monoisotopic Mass | 422.06063 |
| SMILES | O=C1C=C[C@H](O)[C@@H]2[C@@H]1C[C@@]13SS[C@]4(C[C@H]5C(=O)CC[C@H](O)[C@H]5N4C1=O)C(=O)N23 |
| InChI | InChI=1S/C18H18N2O6S2/c21-9-1-3-11(23)13-7(9)5-17-15(25)20-14-8(10(22)2-4-12(14)24)6-18(20,28-27-17)16(26)19(13)17/h1,3,7-8,11-14,23-24H,2,4-6H2/t7-,8+,11+,12+,13+,14+,17-,18-/m1/s1 |
| InChIKey | NOMAQNRAYYWNOP-IMHILIGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (25105722) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brocazine B (CHEBI:209395) is a 2,5-diketopiperazines (CHEBI:65061) |
| Brocazine B (CHEBI:209395) is a indoles (CHEBI:24828) |
| Brocazine B (CHEBI:209395) is a organic disulfide (CHEBI:35489) |
| Brocazine B (CHEBI:209395) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1R,4S,5S,9S,11R,14S,15S,19R)-5,15-dihydroxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docos-6-ene-2,8,12,18-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 34981975 | ChemSpider |